CAS 848093-29-8 appears in our catalog under these names: 5-Formylpyridine-3-boronic acid pinacol ester, 95%, 5–Formylpyridine–3–boronic acid pinacol ester, 5-Formylpyridine-3-boronic acid pinacol ester, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinaldehyde 98%, 5-Formylpyridine-3-boronic acid pinacol ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 500mg, 250mg, 100mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbaldehyde (CAS 848093-29-8) is a chemical compound with the molecular formula C12H16BNO3 and a molecular weight of 233.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbaldehyde. InChIKey: WVIMCYHOZKNOCS-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO3 |
|---|---|
| Molecular weight | 233.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbaldehyde |
| InChIKey | WVIMCYHOZKNOCS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C=O |
Computed by PubChem (NCBI)