cas: 340131-70-6 — see every product listed under this CAS number, including other names
2-HYDROXY-3-TERT-BUTYL BENZONITRILE, 97% (CAS 340131-70-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387584-250MG |
| cas | 340131-70-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 1195.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-tert-butyl-2-hydroxybenzonitrile (CAS 340131-70-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3-tert-butyl-2-hydroxybenzonitrile. InChIKey: ZKBIUKNNKXWRNQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3-tert-butyl-2-hydroxybenzonitrile |
| InChIKey | ZKBIUKNNKXWRNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC(=C1O)C#N |
Computed by PubChem (NCBI)