cas: 2980-33-8 — see every product listed under this CAS number, including other names
2-Hydroxy-3,5-dinitropyridine, 98% (CAS 2980-33-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093263-1G |
| cas | 2980-33-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 25g | 721.64 Pln | |
| Fluorochem | 100g | 2221.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dinitro-1H-pyridin-2-one (CAS 2980-33-8) is a chemical compound with the molecular formula C5H3N3O5 and a molecular weight of 185.09 g/mol. IUPAC name: 3,5-dinitro-1H-pyridin-2-one. InChIKey: KSZZJOXNRQKULB-UHFFFAOYSA-N.
| Molecular formula | C5H3N3O5 |
|---|---|
| Molecular weight | 185.09 g/mol |
| IUPAC name | 3,5-dinitro-1H-pyridin-2-one |
| InChIKey | KSZZJOXNRQKULB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)