CAS 10425-71-5 appears in our catalog under these names: 3,5-dinitropyridin-4-ol, 3,5-Dinitro-4-pyridinol, 3,5-Dinitro-pyridin-4-ol. Offered by: Chemat Brand, TRC, Fluorochem. Available pack sizes: on request, 1g, 2,5g, 250mg, 5g.
3,5-dinitro-1H-pyridin-4-one (CAS 10425-71-5) is a chemical compound with the molecular formula C5H3N3O5 and a molecular weight of 185.09 g/mol. IUPAC name: 3,5-dinitro-1H-pyridin-4-one. InChIKey: PUHTYORYOUQZEB-UHFFFAOYSA-N.
| Molecular formula | C5H3N3O5 |
|---|---|
| Molecular weight | 185.09 g/mol |
| IUPAC name | 3,5-dinitro-1H-pyridin-4-one |
| InChIKey | PUHTYORYOUQZEB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=CN1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)