cas: 1354819-26-3 — see every product listed under this CAS number, including other names
2-Hydroxy-5-(trifluoromethoxy)phenylboronic acid, 96%, 96% (CAS 1354819-26-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU75-250mg |
| cas | 1354819-26-3 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 880.40 Pln | |
| Chemat | 10g | 1456.40 Pln | |
| Chemat | 25g | 2680.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1354819-26-3) is a chemical compound with the molecular formula C7H6BF3O4 and a molecular weight of 221.93 g/mol. IUPAC name: [2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: KZPLYVRPYPBPSQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O4 |
|---|---|
| Molecular weight | 221.93 g/mol |
| IUPAC name | [2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | KZPLYVRPYPBPSQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)O)(O)O |
Computed by PubChem (NCBI)