CAS 1354819-26-3 appears in our catalog under these names: 2-Hydroxy-5-(trifluoromethoxy)phenylboronic acid, 96%, 2-Hydroxy-5-(trifluoromethoxy)phenylboronic Acid, >95% (HPLC), 2-Hydroxy-5-(trifluoromethoxy)phenylboronic acid 96%, 2-Hydroxy-5-(trifluoromethoxy)phenylboronic acid, 96%, 96%. Offered by: Combi-blocks, TRC, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.
[2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1354819-26-3) is a chemical compound with the molecular formula C7H6BF3O4 and a molecular weight of 221.93 g/mol. IUPAC name: [2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: KZPLYVRPYPBPSQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O4 |
|---|---|
| Molecular weight | 221.93 g/mol |
| IUPAC name | [2-hydroxy-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | KZPLYVRPYPBPSQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)O)(O)O |
Computed by PubChem (NCBI)