cas: 3264-10-6 — see every product listed under this CAS number, including other names
2-Hydroxy-5-nitropyrimidine, 98%, 98% (CAS 3264-10-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7X2-100g |
| cas | 3264-10-6 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 1715.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 578.00 Pln | |
| Chemat | 50g | 1029.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitro-1H-pyrimidin-2-one (CAS 3264-10-6) is a chemical compound with the molecular formula C4H3N3O3 and a molecular weight of 141.09 g/mol. IUPAC name: 5-nitro-1H-pyrimidin-2-one. InChIKey: ZNNRVSOVVLYQBV-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O3 |
|---|---|
| Molecular weight | 141.09 g/mol |
| IUPAC name | 5-nitro-1H-pyrimidin-2-one |
| InChIKey | ZNNRVSOVVLYQBV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)