CAS 219543-69-8 appears in our catalog under these names: 4-Hydroxy-5-nitropyrimidine, 95%, 4–Hydroxy–5–nitropyrimidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
5-nitro-1H-pyrimidin-6-one (CAS 219543-69-8) is a chemical compound with the molecular formula C4H3N3O3 and a molecular weight of 141.09 g/mol. IUPAC name: 5-nitro-1H-pyrimidin-6-one. InChIKey: LLVGNTFQVMZZPW-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O3 |
|---|---|
| Molecular weight | 141.09 g/mol |
| IUPAC name | 5-nitro-1H-pyrimidin-6-one |
| InChIKey | LLVGNTFQVMZZPW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)