cas: 2379560-89-9 — see every product listed under this CAS number, including other names
2-Hydroxy-6-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzaldehyde, 96% (CAS 2379560-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F737180-100MG |
| cas | 2379560-89-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 1g | 1539.06 Pln | |
| Fluorochem | 5g | 5214.85 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-hydroxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2379560-89-9) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 2-hydroxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: UKWVSMKUNWTVIN-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 2-hydroxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | UKWVSMKUNWTVIN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)O)C=O |
Computed by PubChem (NCBI)