cas: 2379560-89-9 — see every product listed under this CAS number, including other names
2-Hydroxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 96% (CAS 2379560-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A824995-100mg |
| cas | 2379560-89-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1638.62 Pln | |
| Ambeed | 5g | 5098.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A824995 |
2-hydroxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2379560-89-9) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 2-hydroxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: UKWVSMKUNWTVIN-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 2-hydroxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | UKWVSMKUNWTVIN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)O)C=O |
Computed by PubChem (NCBI)