cas: 28080-54-8 — see every product listed under this CAS number, including other names
2-Iodo-5-nitropyridine 97% (CAS 28080-54-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A631695-250mg |
| cas | 28080-54-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 609.56 Pln | |
| Ambeed | 25g | 1961.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A631695 |
2-iodo-5-nitropyridine (CAS 28080-54-8) is a chemical compound with the molecular formula C5H3IN2O2 and a molecular weight of 249.99 g/mol. IUPAC name: 2-iodo-5-nitropyridine. InChIKey: SJXWHBQWFBHASX-UHFFFAOYSA-N.
| Molecular formula | C5H3IN2O2 |
|---|---|
| Molecular weight | 249.99 g/mol |
| IUPAC name | 2-iodo-5-nitropyridine |
| InChIKey | SJXWHBQWFBHASX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])I |
Computed by PubChem (NCBI)