CAS 89283-69-2 is the registry number for 2-Iodo-4-nitropyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-4-nitropyridine (CAS 89283-69-2) is a chemical compound with the molecular formula C5H3IN2O2 and a molecular weight of 249.99 g/mol. IUPAC name: 2-iodo-4-nitropyridine. InChIKey: OKGBNUAMJSJMQJ-UHFFFAOYSA-N.
| Molecular formula | C5H3IN2O2 |
|---|---|
| Molecular weight | 249.99 g/mol |
| IUPAC name | 2-iodo-4-nitropyridine |
| InChIKey | OKGBNUAMJSJMQJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])I |
Computed by PubChem (NCBI)