cas: 871839-91-7 — see every product listed under this CAS number, including other names
2-Isopropoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98% (CAS 871839-91-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227996-1G |
| cas | 871839-91-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 25g | 2002.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 871839-91-7) is a chemical compound with the molecular formula C14H22BNO3 and a molecular weight of 263.14 g/mol. IUPAC name: 2-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: WCAIJTJWLUYXIW-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO3 |
|---|---|
| Molecular weight | 263.14 g/mol |
| IUPAC name | 2-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | WCAIJTJWLUYXIW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OC(C)C |
Computed by PubChem (NCBI)