cas: 5495-84-1 — see every product listed under this CAS number, including other names
2-Isopropylthioxanthone 98% (CAS 5495-84-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A901032-25g |
| cas | 5495-84-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 192.38 Pln | |
| Ambeed | 500g | 448.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A901032 |
2-propan-2-ylthioxanthen-9-one (CAS 5495-84-1) is a chemical compound with the molecular formula C16H14OS and a molecular weight of 254.3 g/mol. IUPAC name: 2-propan-2-ylthioxanthen-9-one. InChIKey: KTALPKYXQZGAEG-UHFFFAOYSA-N.
| Molecular formula | C16H14OS |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 2-propan-2-ylthioxanthen-9-one |
| InChIKey | KTALPKYXQZGAEG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)SC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)