CAS 132630-11-6 is the registry number for 5-(Benzylthio)-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-benzylsulfanyl-2,3-dihydroinden-1-one (CAS 132630-11-6) is a chemical compound with the molecular formula C16H14OS and a molecular weight of 254.3 g/mol. IUPAC name: 5-benzylsulfanyl-2,3-dihydroinden-1-one. InChIKey: NGXXHHAPSDACRB-UHFFFAOYSA-N.
| Molecular formula | C16H14OS |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 5-benzylsulfanyl-2,3-dihydroinden-1-one |
| InChIKey | NGXXHHAPSDACRB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2)SCC3=CC=CC=C3 |
Computed by PubChem (NCBI)