cas: 6742-82-1 — see every product listed under this CAS number, including other names
2-METHYL-5-(TRIFLUOROMETHYL)-1H-BENZIMIDAZOLE, 96%, 96% (CAS 6742-82-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FBX0-1g |
| cas | 6742-82-1 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 678.80 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 338.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-methyl-6-(trifluoromethyl)-1H-benzimidazole (CAS 6742-82-1) is a chemical compound with the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. IUPAC name: 2-methyl-6-(trifluoromethyl)-1H-benzimidazole. InChIKey: MXJRRPABGUWERH-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 2-methyl-6-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | MXJRRPABGUWERH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)