cas: 38201-64-8 — see every product listed under this CAS number, including other names
2-Mercapto-5,6-dimethylthieno[2,3-d]pyrimidin-4(3H)-one, 95%, 95% (CAS 38201-64-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJ8Y-100mg |
| cas | 38201-64-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1019.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 38201-64-8) is a chemical compound with the molecular formula C8H8N2OS2 and a molecular weight of 212.3 g/mol. IUPAC name: 5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: WPZYPEIFPBHUDG-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | 5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | WPZYPEIFPBHUDG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=S)N2)C |
Computed by PubChem (NCBI)