cas: 38201-64-8 — see every product listed under this CAS number, including other names
2-Mercapto-5,6-dimethylthieno(2,3-d)pyrimidin-4(3H)-one, 97% (CAS 38201-64-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A823929-1g |
| cas | 38201-64-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4301.50 Pln | |
| AmBeed | 5g | 15303.40 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 38201-64-8) is a chemical compound with the molecular formula C8H8N2OS2 and a molecular weight of 212.3 g/mol. IUPAC name: 5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: WPZYPEIFPBHUDG-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | 5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | WPZYPEIFPBHUDG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=S)N2)C |
Computed by PubChem (NCBI)