cas: 761440-71-5 — see every product listed under this CAS number, including other names
2-Methoxy-4-((1-methylpiperidin-4-yl)oxy)aniline 95% (CAS 761440-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A110504-100mg |
| cas | 761440-71-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 726.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A110504 |
2-methoxy-4-(1-methylpiperidin-4-yl)oxyaniline (CAS 761440-71-5) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: 2-methoxy-4-(1-methylpiperidin-4-yl)oxyaniline. InChIKey: XTWVCSNXEQMXKX-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 2-methoxy-4-(1-methylpiperidin-4-yl)oxyaniline |
| InChIKey | XTWVCSNXEQMXKX-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)OC2=CC(=C(C=C2)N)OC |
Computed by PubChem (NCBI)