Products 180147-34-6

CAS 180147-34-6 is the registry number for [2-(2-Amino-phenyl)-ethyl]-carbamic acid tert-butyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(2-aminophenyl)ethyl]carbamate (CAS 180147-34-6) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: tert-butyl N-[2-(2-aminophenyl)ethyl]carbamate. InChIKey: NRAJUZPLCXKIRP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O2
Molecular weight236.31 g/mol
IUPAC nametert-butyl N-[2-(2-aminophenyl)ethyl]carbamate
InChIKeyNRAJUZPLCXKIRP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC1=CC=CC=C1N

Computed by PubChem (NCBI)