cas: 761440-91-9 — see every product listed under this CAS number, including other names
2-Methoxy-4-(4-morpholinopiperidin-1-yl)aniline, 98% (CAS 761440-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F613522-100MG |
| cas | 761440-91-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 1049.65 Pln | |
| Fluorochem | 1g | 2580.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)aniline (CAS 761440-91-9) is a chemical compound with the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. IUPAC name: 2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)aniline. InChIKey: VOGIRDWDQHZNNW-UHFFFAOYSA-N.
| Molecular formula | C16H25N3O2 |
|---|---|
| Molecular weight | 291.39 g/mol |
| IUPAC name | 2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)aniline |
| InChIKey | VOGIRDWDQHZNNW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCC(CC2)N3CCOCC3)N |
Computed by PubChem (NCBI)