Products 1159976-34-7

CAS 1159976-34-7 is the registry number for 3-(4-Amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(4-aminoanilino)piperidine-1-carboxylate (CAS 1159976-34-7) is a chemical compound with the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. IUPAC name: tert-butyl 3-(4-aminoanilino)piperidine-1-carboxylate. InChIKey: MYQLNRTXRVGABL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25N3O2
Molecular weight291.39 g/mol
IUPAC nametert-butyl 3-(4-aminoanilino)piperidine-1-carboxylate
InChIKeyMYQLNRTXRVGABL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)NC2=CC=C(C=C2)N

Computed by PubChem (NCBI)