cas: 286441-68-7 — see every product listed under this CAS number, including other names
2-Methoxy-4-(trifluoromethyl)benzyl alcohol 95% (CAS 286441-68-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A529644-250mg |
| cas | 286441-68-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 2189.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A529644 |
[2-methoxy-4-(trifluoromethyl)phenyl]methanol (CAS 286441-68-7) is a chemical compound with the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. IUPAC name: [2-methoxy-4-(trifluoromethyl)phenyl]methanol. InChIKey: OHEBPFPPZUWWHD-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | [2-methoxy-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | OHEBPFPPZUWWHD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)