cas: 269410-23-3 — see every product listed under this CAS number, including other names
2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97%, 97% (CAS 269410-23-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149UI-100mg |
| cas | 269410-23-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1154.00 Pln | |
| Chemat | 10g | 1917.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 269410-23-3) is a chemical compound with the molecular formula C13H19BO4 and a molecular weight of 250.10 g/mol. IUPAC name: 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: WINSAMQIAMEZIK-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4 |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | WINSAMQIAMEZIK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)O |
Computed by PubChem (NCBI)