CAS 2121514-31-4 appears in our catalog under these names: 2-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%, 2-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2121514-31-4) is a chemical compound with the molecular formula C13H19BO4 and a molecular weight of 250.10 g/mol. IUPAC name: 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: AQXQPYZUYHUEAU-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4 |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | AQXQPYZUYHUEAU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)O)OC |
Computed by PubChem (NCBI)