cas: 685126-89-0 — see every product listed under this CAS number, including other names
2-Methoxy-5-(trifluoromethyl)benzyl alcohol, 98% (CAS 685126-89-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F342619-5G |
| cas | 685126-89-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 919.49 Pln | |
| Fluorochem | 25g | 2205.49 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[2-methoxy-5-(trifluoromethyl)phenyl]methanol (CAS 685126-89-0) is a chemical compound with the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. IUPAC name: [2-methoxy-5-(trifluoromethyl)phenyl]methanol. InChIKey: CWHHRWFFYKXTBK-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | [2-methoxy-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | CWHHRWFFYKXTBK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)