cas: 5446-92-4 — see every product listed under this CAS number, including other names
2-Methoxy-5-nitropyridine 98% (CAS 5446-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108211-100g |
| cas | 5446-92-4 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108211 |
2-methoxy-5-nitropyridine (CAS 5446-92-4) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 2-methoxy-5-nitropyridine. InChIKey: WUPLOZFIOAEYMG-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 2-methoxy-5-nitropyridine |
| InChIKey | WUPLOZFIOAEYMG-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)