cas: 944900-09-8 — see every product listed under this CAS number, including other names
2-Methoxy-6-(trifluoromethyl)pyridin-3-amine 97% (CAS 944900-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A191078-100mg |
| cas | 944900-09-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2167.06 Pln | |
| Ambeed | 10g | 3891.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A191078 |
2-methoxy-6-(trifluoromethyl)pyridin-3-amine (CAS 944900-09-8) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 2-methoxy-6-(trifluoromethyl)pyridin-3-amine. InChIKey: CACVEEZPWDHLFI-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 2-methoxy-6-(trifluoromethyl)pyridin-3-amine |
| InChIKey | CACVEEZPWDHLFI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)C(F)(F)F)N |
Computed by PubChem (NCBI)