CAS 1250672-75-3 appears in our catalog under these names: 3-Amino-1-(2,2,2-trifluoroethyl)-1,2-dihydropyridin-2-one, 95%, 3-Amino-1-(2,2,2-trifluoroethyl)pyridin-2(1H)-one, 97%, 3-Amino-1-(2,2,2-trifluoroethyl)-1,2-dihydropyridin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
3-amino-1-(2,2,2-trifluoroethyl)pyridin-2-one (CAS 1250672-75-3) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 3-amino-1-(2,2,2-trifluoroethyl)pyridin-2-one. InChIKey: BYGRUUJKXBHKIK-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 3-amino-1-(2,2,2-trifluoroethyl)pyridin-2-one |
| InChIKey | BYGRUUJKXBHKIK-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)N)CC(F)(F)F |
Computed by PubChem (NCBI)