2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride, 98%
cas: 138564-60-0 — see every product listed under this CAS number, including other names
2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride, 98% (CAS 138564-60-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076506-5G |
| cas | 138564-60-0 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 258.26 Pln | |
| Fluorochem | 50g | 357.18 Pln | |
| Fluorochem | 100g | 544.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride (CAS 138564-60-0) is a chemical compound with the molecular formula C12H12ClN3S and a molecular weight of 265.76 g/mol. IUPAC name: 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride. InChIKey: FDWMAKNNNPSUTL-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3S |
|---|---|
| Molecular weight | 265.76 g/mol |
| IUPAC name | 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride |
| InChIKey | FDWMAKNNNPSUTL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride, 4-Amino-2-methyl-10H-thiene[2,3-b][1,5]benzodiazepine hydrochloride, 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride, 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine hydrochloride, C12H12ClN3S, Olanzamine hydrochloride, 10H-Thieno[2,3-b][1,5]benzodiazepin-4-amine, 2-methyl-,monohydrochloride, 2-methyl-10H-benzo[b]thiopheno[3,2-f]1,4-diazepine-4-ylamine, chloride, 4-amino-2-methyl-10h-thieno[2,3-b][1,5]-benzodiazepine hydrochloride, 2-methyl-5H-thieno[3,2-c][1,5]benzodiazepin-4-amine