CAS 138564-60-0 appears in our catalog under these names: 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine hydrochloride, 98%, Olanzapine Impurity 6 HCl, 4-Amino-2-methyl-10H-thieno(2,3-b)(1,5)-benzodiazapine, Hydrochloride, >95% (HPLC), 4-Amino-2-methyl-10H-thieno(2,3-b)(1,5)-benzodiazepine Hydrochloride, Olanzapine impurity L HCl. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 10g, 100g, 5g, 25g, 1g, on request, 100mg, 250mg.
2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride (CAS 138564-60-0) is a chemical compound with the molecular formula C12H12ClN3S and a molecular weight of 265.76 g/mol. IUPAC name: 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride. InChIKey: FDWMAKNNNPSUTL-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3S |
|---|---|
| Molecular weight | 265.76 g/mol |
| IUPAC name | 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine;hydrochloride |
| InChIKey | FDWMAKNNNPSUTL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N.Cl |
Computed by PubChem (NCBI)