cas: 288379-50-0 — see every product listed under this CAS number, including other names
2-Methyl-2-(piperazin-1-yl)propanamide dihydrochloride, 95%, 95% (CAS 288379-50-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WQ2-100mg |
| cas | 288379-50-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1970.00 Pln | |
| Chemat | 250mg | 2546.00 Pln | |
| Chemat | 1g | 5032.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-2-piperazin-1-ylpropanamide;dihydrochloride (CAS 288379-50-0) is a chemical compound with the molecular formula C8H19Cl2N3O and a molecular weight of 244.16 g/mol. IUPAC name: 2-methyl-2-piperazin-1-ylpropanamide;dihydrochloride. InChIKey: VQTRIBPJPZYNOJ-UHFFFAOYSA-N.
| Molecular formula | C8H19Cl2N3O |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | 2-methyl-2-piperazin-1-ylpropanamide;dihydrochloride |
| InChIKey | VQTRIBPJPZYNOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)N)N1CCNCC1.Cl.Cl |
Computed by PubChem (NCBI)