CAS 288379-50-0 appears in our catalog under these names: 2-Methyl-2-(piperazin-1-yl)propanamide dihydrochloride, 95%, 2–Methyl–2–(piperazin–1–yl)propanamide dihydrochloride, 2-Methyl-2-(piperazin-1-yl)propanamide dihydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-methyl-2-piperazin-1-ylpropanamide;dihydrochloride (CAS 288379-50-0) is a chemical compound with the molecular formula C8H19Cl2N3O and a molecular weight of 244.16 g/mol. IUPAC name: 2-methyl-2-piperazin-1-ylpropanamide;dihydrochloride. InChIKey: VQTRIBPJPZYNOJ-UHFFFAOYSA-N.
| Molecular formula | C8H19Cl2N3O |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | 2-methyl-2-piperazin-1-ylpropanamide;dihydrochloride |
| InChIKey | VQTRIBPJPZYNOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)N)N1CCNCC1.Cl.Cl |
Computed by PubChem (NCBI)