cas: 2707-93-9 — see every product listed under this CAS number, including other names
2-Methyl-2-(trifluoroacetamido)propanoic acid, 96%, 96% (CAS 2707-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BE70-100mg |
| cas | 2707-93-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 688.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (CAS 2707-93-9) is a chemical compound with the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. IUPAC name: 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid. InChIKey: HJBCAOHCOZDCCY-UHFFFAOYSA-N.
| Molecular formula | C6H8F3NO3 |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| InChIKey | HJBCAOHCOZDCCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)