Products 1502528-58-6

CAS 1502528-58-6 is the registry number for 6-(Trifluoromethyl)morpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-(trifluoromethyl)morpholine-3-carboxylic acid (CAS 1502528-58-6) is a chemical compound with the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. IUPAC name: 6-(trifluoromethyl)morpholine-3-carboxylic acid. InChIKey: TUSDITNANYMPPH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8F3NO3
Molecular weight199.13 g/mol
IUPAC name6-(trifluoromethyl)morpholine-3-carboxylic acid
InChIKeyTUSDITNANYMPPH-UHFFFAOYSA-N
SMILESC1C(OCC(N1)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)