cas: 108097-02-5 — see every product listed under this CAS number, including other names
2-Methyl-4,7,8-trichloroquinoline, 98% (CAS 108097-02-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F955786-1G |
| cas | 108097-02-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1002.79 Pln | |
| Fluorochem | 5g | 1846.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,7,8-trichloro-2-methylquinoline (CAS 108097-02-5) is a chemical compound with the molecular formula C10H6Cl3N and a molecular weight of 246.5 g/mol. IUPAC name: 4,7,8-trichloro-2-methylquinoline. InChIKey: YWSNYNKOWMWXRR-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 4,7,8-trichloro-2-methylquinoline |
| InChIKey | YWSNYNKOWMWXRR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC(=C(C2=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)