cas: 108097-02-5 — see every product listed under this CAS number, including other names
4,7,8-Trichloro-2-methylquinoline, 97%, 97% (CAS 108097-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118V90-100mg |
| cas | 108097-02-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1490.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,7,8-trichloro-2-methylquinoline (CAS 108097-02-5) is a chemical compound with the molecular formula C10H6Cl3N and a molecular weight of 246.5 g/mol. IUPAC name: 4,7,8-trichloro-2-methylquinoline. InChIKey: YWSNYNKOWMWXRR-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 4,7,8-trichloro-2-methylquinoline |
| InChIKey | YWSNYNKOWMWXRR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC(=C(C2=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)