cas: 627906-52-9 — see every product listed under this CAS number, including other names
2-Methyl-4-(4,4,5,5-tetraMethyl-1,3,2-Dioxaborolan-2-yl)Phenol, 98%, 98% (CAS 627906-52-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EL57-100mg |
| cas | 627906-52-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 990.80 Pln | |
| Chemat | 10g | 1648.40 Pln | |
| Chemat | 25g | 3462.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 627906-52-9) is a chemical compound with the molecular formula C13H19BO3 and a molecular weight of 234.10 g/mol. IUPAC name: 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: WWKXCYNPIQEAKJ-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | WWKXCYNPIQEAKJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)C |
Computed by PubChem (NCBI)