CAS 934558-31-3 appears in our catalog under these names: 2-(4-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane, 95%, 2-(4-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane, 95-<97%, 2-(4-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane, ≥97-<99%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 5g, 1g, 250mg, 25g, 50g, 100g, 200g, 300g.
2-(4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane (CAS 934558-31-3) is a chemical compound with the molecular formula C13H19BO3 and a molecular weight of 234.10 g/mol. IUPAC name: 2-(4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane. InChIKey: LXPXXDGLEYPUQK-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
| InChIKey | LXPXXDGLEYPUQK-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)