cas: 1218791-01-5 — see every product listed under this CAS number, including other names
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole 96% (CAS 1218791-01-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1359088-100mg |
| cas | 1218791-01-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1427.25 Pln | |
| Ambeed | 25g | 5404.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1359088 |
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1218791-01-5) is a chemical compound with the molecular formula C10H16BNO2S and a molecular weight of 225.12 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: QXMZPGMBRRZCDV-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2S |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | QXMZPGMBRRZCDV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)C |
Computed by PubChem (NCBI)