cas: 1218791-01-5 — see every product listed under this CAS number, including other names
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 97%, 97% (CAS 1218791-01-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127B7-10g |
| cas | 1218791-01-5 |
| size | 10g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1682.00 Pln | |
| Chemat | 50g | 7437.20 Pln | |
| Chemat | 100g | 13346.00 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 25g | 3851.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1218791-01-5) is a chemical compound with the molecular formula C10H16BNO2S and a molecular weight of 225.12 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: QXMZPGMBRRZCDV-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2S |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | QXMZPGMBRRZCDV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)C |
Computed by PubChem (NCBI)