2-Methyl-5-(trifluoromethyl)benzonitrile 98%
cas: 261952-03-8 — see every product listed under this CAS number, including other names
2-Methyl-5-(trifluoromethyl)benzonitrile 98% (CAS 261952-03-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A125652-250mg |
| cas | 261952-03-8 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 709.69 Pln | |
| Ambeed | 25g | 2311.69 Pln | |
| Ambeed | 100g | 7245.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A125652 |
2-methyl-5-(trifluoromethyl)benzonitrile (CAS 261952-03-8) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)benzonitrile. InChIKey: NKYUMNAHEJWIND-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)benzonitrile |
| InChIKey | NKYUMNAHEJWIND-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)