CAS 362640-56-0 is the registry number for 2-Methyl-4-(trifluoromethyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-4-(trifluoromethyl)benzonitrile (CAS 362640-56-0) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 2-methyl-4-(trifluoromethyl)benzonitrile. InChIKey: RGABUAQUWGBFSG-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-methyl-4-(trifluoromethyl)benzonitrile |
| InChIKey | RGABUAQUWGBFSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)