cas: 18955-88-9 — see every product listed under this CAS number, including other names
2-Methyl-5-(trifluoromethyl)oxazole-4-carboxylic acid, 97% (CAS 18955-88-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1475497-1g |
| cas | 18955-88-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8513.47 Pln | |
| AmBeed | 250mg | 4093.18 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 18955-88-9) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: CPJRDBNLRNFKFI-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | CPJRDBNLRNFKFI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)