CAS 18955-88-9 appears in our catalog under these names: 2-Methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid, 95%, 2-Methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic Acid, 2-Methyl-5-(trifluoromethyl)oxazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 1g, 5g, 500mg.
2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 18955-88-9) is a chemical compound with the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: CPJRDBNLRNFKFI-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | CPJRDBNLRNFKFI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)