cas: 84487-12-7 — see every product listed under this CAS number, including other names
2-Methyl-5-nitropyridin-4-amine, 98% (CAS 84487-12-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A535700-5g |
| cas | 84487-12-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17673.04 Pln | |
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 250mg | 935.11 Pln | |
| Fluorochem | 1g | 2247.14 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methyl-5-nitropyridin-4-amine (CAS 84487-12-7) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-5-nitropyridin-4-amine. InChIKey: VZJFKMKJRWIRMF-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-5-nitropyridin-4-amine |
| InChIKey | VZJFKMKJRWIRMF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)