cas: 61931-68-8 — see every product listed under this CAS number, including other names
2-Methyl-5-phenylbenzo[d]oxazole (CAS 61931-68-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235692-1G |
| cas | 61931-68-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 268.67 Pln | |
| Fluorochem | 25g | 700.81 Pln |
| delivery time | 3-4 weeks |
|---|
2-methyl-5-phenyl-1,3-benzoxazole (CAS 61931-68-8) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 2-methyl-5-phenyl-1,3-benzoxazole. InChIKey: CHZDPBVCBBQQRP-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-methyl-5-phenyl-1,3-benzoxazole |
| InChIKey | CHZDPBVCBBQQRP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=CC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)