CAS 40643-14-9 appears in our catalog under these names: 4-(1H-Indol-2-yl)phenol, 95%, 4-(1H-Indol-2-yl)phenol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
4-(1H-indol-2-yl)phenol (CAS 40643-14-9) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 4-(1H-indol-2-yl)phenol. InChIKey: BQWAJIFVKAXHCO-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-(1H-indol-2-yl)phenol |
| InChIKey | BQWAJIFVKAXHCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)