cas: 804560-00-7 — see every product listed under this CAS number, including other names
2-Methyl-9,10-di(naphthalen-2-yl)anthracene, 97%, 97% (CAS 804560-00-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8VC-100mg |
| cas | 804560-00-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1744.40 Pln | |
| Chemat | 5g | 5114.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-9,10-dinaphthalen-2-ylanthracene (CAS 804560-00-7) is a chemical compound with the molecular formula C35H24 and a molecular weight of 444.6 g/mol. IUPAC name: 2-methyl-9,10-dinaphthalen-2-ylanthracene. InChIKey: HNWFFTUWRIGBNM-UHFFFAOYSA-N.
| Molecular formula | C35H24 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | 2-methyl-9,10-dinaphthalen-2-ylanthracene |
| InChIKey | HNWFFTUWRIGBNM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)