CAS 863497-34-1 is the registry number for Poly((9,9-dihexylfluorenyl-2,7-diyl)-co-(9,10-anthracene)). Offered by: Lumtec. Available pack sizes: On request.
2-methyl-9,10-dinaphthalen-1-ylanthracene (CAS 863497-34-1) is a chemical compound with the molecular formula C35H24 and a molecular weight of 444.6 g/mol. IUPAC name: 2-methyl-9,10-dinaphthalen-1-ylanthracene. InChIKey: PGBFVDVTXFHOHV-UHFFFAOYSA-N.
| Molecular formula | C35H24 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | 2-methyl-9,10-dinaphthalen-1-ylanthracene |
| InChIKey | PGBFVDVTXFHOHV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC=CC5=CC=CC=C54)C6=CC=CC7=CC=CC=C76 |
Computed by PubChem (NCBI)